C15H12Br2O3S — CID 107739217
(E)-3-[3,5-dibromo-4-(2-thiophen-3-ylethoxy)phenyl]prop-2-enoic acid (PubChem CID 107739217) has the molecular formula C15H12Br2O3S and a molecular weight of 432.13 g/mol. Its IUPAC name is (E)-3-[3,5-dibromo-4-(2-thiophen-3-ylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dibromo-4-(2-thiophen-3-ylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107739217 |
| Molecular Formula | C15H12Br2O3S |
| Molecular Weight | 432.13 g/mol |
| Exact Mass | 429.89 |
| IUPAC Name | (E)-3-[3,5-dibromo-4-(2-thiophen-3-ylethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(Br)c(OCCc2ccsc2)c(Br)c1 |
| InChI | InChI=1S/C15H12Br2O3S/c16-12-7-11(1-2-14(18)19)8-13(17)15(12)20-5-3-10-4-6-21-9-10/h1-2,4,6-9H,3,5H2,(H,18,19)/b2-1+ |
| InChIKey | PPCPKOAILXRLQW-OWOJBTEDSA-N |
| XLogP | 4.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.13 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|