C14H11BrO3S — CID 55145814
(E)-3-[3-bromo-4-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 55145814) has the molecular formula C14H11BrO3S and a molecular weight of 339.21 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-bromo-4-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 55145814 |
| Molecular Formula | C14H11BrO3S |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | (E)-3-[3-bromo-4-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OCc2ccsc2)c(Br)c1 |
| InChI | InChI=1S/C14H11BrO3S/c15-12-7-10(2-4-14(16)17)1-3-13(12)18-8-11-5-6-19-9-11/h1-7,9H,8H2,(H,16,17)/b4-2+ |
| InChIKey | LTQSKAQYTRDQJA-DUXPYHPUSA-N |
| XLogP | 4.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|