C14H11FO3S — CID 107699473
(E)-3-[5-fluoro-2-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 107699473) has the molecular formula C14H11FO3S and a molecular weight of 278.30 g/mol. Its IUPAC name is (E)-3-[5-fluoro-2-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-fluoro-2-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107699473 |
| Molecular Formula | C14H11FO3S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | (E)-3-[5-fluoro-2-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)ccc1OCc1ccsc1 |
| InChI | InChI=1S/C14H11FO3S/c15-12-2-3-13(11(7-12)1-4-14(16)17)18-8-10-5-6-19-9-10/h1-7,9H,8H2,(H,16,17)/b4-1+ |
| InChIKey | TWDNUZQCVNBKOC-DAFODLJHSA-N |
| XLogP | 3.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|