C14H11FN2O3 — CID 107699661
(E)-3-[5-fluoro-2-(pyrimidin-2-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 107699661) has the molecular formula C14H11FN2O3 and a molecular weight of 274.25 g/mol. Its IUPAC name is (E)-3-[5-fluoro-2-(pyrimidin-2-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-fluoro-2-(pyrimidin-2-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107699661 |
| Molecular Formula | C14H11FN2O3 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (E)-3-[5-fluoro-2-(pyrimidin-2-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(F)ccc1OCc1ncccn1 |
| InChI | InChI=1S/C14H11FN2O3/c15-11-3-4-12(10(8-11)2-5-14(18)19)20-9-13-16-6-1-7-17-13/h1-8H,9H2,(H,18,19)/b5-2+ |
| InChIKey | RIGCTFUMUUKNHT-GORDUTHDSA-N |
| XLogP | 2.29 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|