C14H15FO5 — CID 107699666
3-[2-[(E)-2-carboxyethenyl]-4-fluorophenoxy]-2,2-dimethylpropanoic acid (PubChem CID 107699666) has the molecular formula C14H15FO5 and a molecular weight of 282.27 g/mol. Its IUPAC name is 3-[2-[(E)-2-carboxyethenyl]-4-fluorophenoxy]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[2-[(E)-2-carboxyethenyl]-4-fluorophenoxy]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 107699666 |
| Molecular Formula | C14H15FO5 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-[2-[(E)-2-carboxyethenyl]-4-fluorophenoxy]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(COc1ccc(F)cc1/C=C/C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H15FO5/c1-14(2,13(18)19)8-20-11-5-4-10(15)7-9(11)3-6-12(16)17/h3-7H,8H2,1-2H3,(H,16,17)(H,18,19)/b6-3+ |
| InChIKey | CEMIYFLUZBFBLS-ZZXKWVIFSA-N |
| XLogP | 2.41 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|