C17H15FO3 — CID 77011444
3-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]prop-2-enoic acid (PubChem CID 77011444) has the molecular formula C17H15FO3 and a molecular weight of 286.30 g/mol. Its IUPAC name is 3-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]prop-2-enoic acid.
| Compound Name | 3-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77011444 |
| Molecular Formula | C17H15FO3 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[2-[(4-fluorophenyl)methoxy]-5-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(OCc2ccc(F)cc2)c(C=CC(=O)O)c1 |
| InChI | InChI=1S/C17H15FO3/c1-12-2-8-16(14(10-12)5-9-17(19)20)21-11-13-3-6-15(18)7-4-13/h2-10H,11H2,1H3,(H,19,20) |
| InChIKey | IVBHCFLJEVIMGB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|