C15H14O4S — CID 43646383
(E)-3-[4-methoxy-3-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 43646383) has the molecular formula C15H14O4S and a molecular weight of 290.34 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-methoxy-3-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43646383 |
| Molecular Formula | C15H14O4S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (E)-3-[4-methoxy-3-(thiophen-3-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1OCc1ccsc1 |
| InChI | InChI=1S/C15H14O4S/c1-18-13-4-2-11(3-5-15(16)17)8-14(13)19-9-12-6-7-20-10-12/h2-8,10H,9H2,1H3,(H,16,17)/b5-3+ |
| InChIKey | UAFNXJKIYIZYCH-HWKANZROSA-N |
| XLogP | 3.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|