C14H12BrNO4 — CID 76983122
3-[3-bromo-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 76983122) has the molecular formula C14H12BrNO4 and a molecular weight of 338.16 g/mol. Its IUPAC name is 3-[3-bromo-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-bromo-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76983122 |
| Molecular Formula | C14H12BrNO4 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 3-[3-bromo-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(COc2ccc(C=CC(=O)O)cc2Br)on1 |
| InChI | InChI=1S/C14H12BrNO4/c1-9-6-11(20-16-9)8-19-13-4-2-10(7-12(13)15)3-5-14(17)18/h2-7H,8H2,1H3,(H,17,18) |
| InChIKey | RDIKNKLEJFJRIU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|