C19H19BrO4 — CID 20989484
3-[3-bromo-4-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 20989484) has the molecular formula C19H19BrO4 and a molecular weight of 391.26 g/mol. Its IUPAC name is 3-[3-bromo-4-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-bromo-4-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20989484 |
| Molecular Formula | C19H19BrO4 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 3-[3-bromo-4-[2-(3,5-dimethylphenoxy)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C)cc(OCCOc2ccc(C=CC(=O)O)cc2Br)c1 |
| InChI | InChI=1S/C19H19BrO4/c1-13-9-14(2)11-16(10-13)23-7-8-24-18-5-3-15(12-17(18)20)4-6-19(21)22/h3-6,9-12H,7-8H2,1-2H3,(H,21,22) |
| InChIKey | XDPQOXWETJBFAQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|