C14H11F2NO4 — CID 79881875
3-[3,5-difluoro-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 79881875) has the molecular formula C14H11F2NO4 and a molecular weight of 295.24 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3,5-difluoro-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79881875 |
| Molecular Formula | C14H11F2NO4 |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-[3,5-difluoro-4-[(3-methyl-1,2-oxazol-5-yl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(COc2c(F)cc(C=CC(=O)O)cc2F)on1 |
| InChI | InChI=1S/C14H11F2NO4/c1-8-4-10(21-17-8)7-20-14-11(15)5-9(6-12(14)16)2-3-13(18)19/h2-6H,7H2,1H3,(H,18,19) |
| InChIKey | AVDZKSKEICPFHD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|