C14H9BrF2O3S — CID 79881581
3-[4-[(3-bromothiophen-2-yl)methoxy]-3,5-difluorophenyl]prop-2-enoic acid (PubChem CID 79881581) has the molecular formula C14H9BrF2O3S and a molecular weight of 375.19 g/mol. Its IUPAC name is 3-[4-[(3-bromothiophen-2-yl)methoxy]-3,5-difluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(3-bromothiophen-2-yl)methoxy]-3,5-difluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79881581 |
| Molecular Formula | C14H9BrF2O3S |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | 3-[4-[(3-bromothiophen-2-yl)methoxy]-3,5-difluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(F)c(OCc2sccc2Br)c(F)c1 |
| InChI | InChI=1S/C14H9BrF2O3S/c15-9-3-4-21-12(9)7-20-14-10(16)5-8(6-11(14)17)1-2-13(18)19/h1-6H,7H2,(H,18,19) |
| InChIKey | LWKLBZBDXGPKEZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|