C12H7BrF2O3S — CID 79887626
4-[(3-bromothiophen-2-yl)methoxy]-3,5-difluorobenzoic acid (PubChem CID 79887626) has the molecular formula C12H7BrF2O3S and a molecular weight of 349.15 g/mol. Its IUPAC name is 4-[(3-bromothiophen-2-yl)methoxy]-3,5-difluorobenzoic acid.
| Compound Name | 4-[(3-bromothiophen-2-yl)methoxy]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 79887626 |
| Molecular Formula | C12H7BrF2O3S |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | 4-[(3-bromothiophen-2-yl)methoxy]-3,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(OCc2sccc2Br)c(F)c1 |
| InChI | InChI=1S/C12H7BrF2O3S/c13-7-1-2-19-10(7)5-18-11-8(14)3-6(12(16)17)4-9(11)15/h1-4H,5H2,(H,16,17) |
| InChIKey | PGTLOMUOSJGVLK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |