C16H14F2O3 — CID 79880846
4-[(3,4-dimethylphenyl)methoxy]-3,5-difluorobenzoic acid (PubChem CID 79880846) has the molecular formula C16H14F2O3 and a molecular weight of 292.28 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)methoxy]-3,5-difluorobenzoic acid.
| Compound Name | 4-[(3,4-dimethylphenyl)methoxy]-3,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 79880846 |
| Molecular Formula | C16H14F2O3 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)methoxy]-3,5-difluorobenzoic acid |
| SMILES | Cc1ccc(COc2c(F)cc(C(=O)O)cc2F)cc1C |
| InChI | InChI=1S/C16H14F2O3/c1-9-3-4-11(5-10(9)2)8-21-15-13(17)6-12(16(19)20)7-14(15)18/h3-7H,8H2,1-2H3,(H,19,20) |
| InChIKey | WYAKVVNYLJCVRJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |