C16H14Cl2O3 — CID 63529202
3,5-dichloro-2-[(3,4-dimethylphenyl)methoxy]benzoic acid (PubChem CID 63529202) has the molecular formula C16H14Cl2O3 and a molecular weight of 325.19 g/mol. Its IUPAC name is 3,5-dichloro-2-[(3,4-dimethylphenyl)methoxy]benzoic acid.
| Compound Name | 3,5-dichloro-2-[(3,4-dimethylphenyl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 63529202 |
| Molecular Formula | C16H14Cl2O3 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 3,5-dichloro-2-[(3,4-dimethylphenyl)methoxy]benzoic acid |
| SMILES | Cc1ccc(COc2c(Cl)cc(Cl)cc2C(=O)O)cc1C |
| InChI | InChI=1S/C16H14Cl2O3/c1-9-3-4-11(5-10(9)2)8-21-15-13(16(19)20)6-12(17)7-14(15)18/h3-7H,8H2,1-2H3,(H,19,20) |
| InChIKey | SXWOFVNFSDSFOP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |