C14H11Cl2NO3 — CID 102881324
3,5-dichloro-2-[(5-methyl-3-pyridinyl)methoxy]benzoic acid (PubChem CID 102881324) has the molecular formula C14H11Cl2NO3 and a molecular weight of 312.15 g/mol. Its IUPAC name is 3,5-dichloro-2-[(5-methyl-3-pyridinyl)methoxy]benzoic acid.
| Compound Name | 3,5-dichloro-2-[(5-methyl-3-pyridinyl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 102881324 |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 3,5-dichloro-2-[(5-methyl-3-pyridinyl)methoxy]benzoic acid |
| SMILES | Cc1cncc(COc2c(Cl)cc(Cl)cc2C(=O)O)c1 |
| InChI | InChI=1S/C14H11Cl2NO3/c1-8-2-9(6-17-5-8)7-20-13-11(14(18)19)3-10(15)4-12(13)16/h2-6H,7H2,1H3,(H,18,19) |
| InChIKey | AXMYSCJHKGJGHI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |