C14H13F2NO3S — CID 79880833
3,5-difluoro-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]benzoic acid (PubChem CID 79880833) has the molecular formula C14H13F2NO3S and a molecular weight of 313.32 g/mol. Its IUPAC name is 3,5-difluoro-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]benzoic acid.
| Compound Name | 3,5-difluoro-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 79880833 |
| Molecular Formula | C14H13F2NO3S |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3,5-difluoro-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]benzoic acid |
| SMILES | CCCc1nc(COc2c(F)cc(C(=O)O)cc2F)cs1 |
| InChI | InChI=1S/C14H13F2NO3S/c1-2-3-12-17-9(7-21-12)6-20-13-10(15)4-8(14(18)19)5-11(13)16/h4-5,7H,2-3,6H2,1H3,(H,18,19) |
| InChIKey | JEVRGFORUYMSPZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |