C17H12FNO3S — CID 19901155
3-[[2-(2-fluorophenyl)-1,3-thiazol-4-yl]methoxy]benzoic acid (PubChem CID 19901155) has the molecular formula C17H12FNO3S and a molecular weight of 329.35 g/mol. Its IUPAC name is 3-[[2-(2-fluorophenyl)-1,3-thiazol-4-yl]methoxy]benzoic acid.
| Compound Name | 3-[[2-(2-fluorophenyl)-1,3-thiazol-4-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 19901155 |
| Molecular Formula | C17H12FNO3S |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 3-[[2-(2-fluorophenyl)-1,3-thiazol-4-yl]methoxy]benzoic acid |
| SMILES | O=C(O)c1cccc(OCc2csc(-c3ccccc3F)n2)c1 |
| InChI | InChI=1S/C17H12FNO3S/c18-15-7-2-1-6-14(15)16-19-12(10-23-16)9-22-13-5-3-4-11(8-13)17(20)21/h1-8,10H,9H2,(H,20,21) |
| InChIKey | NKOUBNBGUPPCDK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |