C23H22N2O4S — CID 25117748
4-[4-[(2R)-1-(2-phenoxyacetyl)piperidin-2-yl]-1,3-thiazol-2-yl]benzoic acid (PubChem CID 25117748) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-[4-[(2R)-1-(2-phenoxyacetyl)piperidin-2-yl]-1,3-thiazol-2-yl]benzoic acid.
| Compound Name | 4-[4-[(2R)-1-(2-phenoxyacetyl)piperidin-2-yl]-1,3-thiazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 25117748 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-[4-[(2R)-1-(2-phenoxyacetyl)piperidin-2-yl]-1,3-thiazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc([C@H]3CCCCN3C(=O)COc3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C23H22N2O4S/c26-21(14-29-18-6-2-1-3-7-18)25-13-5-4-8-20(25)19-15-30-22(24-19)16-9-11-17(12-10-16)23(27)28/h1-3,6-7,9-12,15,20H,4-5,8,13-14H2,(H,27,28)/t20-/m1/s1 |
| InChIKey | PYTGLHXTDRPBMK-HXUWFJFHSA-N |
| XLogP | 4.64 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |