C15H17N3O3 — CID 141173736
1-[2-(1,2,4-oxadiazol-5-yl)piperidin-1-yl]-2-phenoxyethanone (PubChem CID 141173736) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-[2-(1,2,4-oxadiazol-5-yl)piperidin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[2-(1,2,4-oxadiazol-5-yl)piperidin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 141173736 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-[2-(1,2,4-oxadiazol-5-yl)piperidin-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCCCC1c1ncno1 |
| InChI | InChI=1S/C15H17N3O3/c19-14(10-20-12-6-2-1-3-7-12)18-9-5-4-8-13(18)15-16-11-17-21-15/h1-3,6-7,11,13H,4-5,8-10H2 |
| InChIKey | ZCPODVUWXDPIFC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |