C22H23N3O3 — CID 110120718
1-[2-(5-benzyl-1,3-oxazol-2-yl)piperidin-1-yl]-2-pyridin-3-yloxyethanone (PubChem CID 110120718) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[2-(5-benzyl-1,3-oxazol-2-yl)piperidin-1-yl]-2-pyridin-3-yloxyethanone.
| Compound Name | 1-[2-(5-benzyl-1,3-oxazol-2-yl)piperidin-1-yl]-2-pyridin-3-yloxyethanone |
|---|---|
| PubChem CID | 110120718 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-[2-(5-benzyl-1,3-oxazol-2-yl)piperidin-1-yl]-2-pyridin-3-yloxyethanone |
| SMILES | O=C(COc1cccnc1)N1CCCCC1c1ncc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C22H23N3O3/c26-21(16-27-18-9-6-11-23-14-18)25-12-5-4-10-20(25)22-24-15-19(28-22)13-17-7-2-1-3-8-17/h1-3,6-9,11,14-15,20H,4-5,10,12-13,16H2 |
| InChIKey | APDMTFINZGJNDO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |