C18H22N2O3 — CID 124955389
1-[(2S)-2-(5-benzyl-1,3-oxazol-2-yl)piperidin-1-yl]-2-methoxyethanone (PubChem CID 124955389) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-[(2S)-2-(5-benzyl-1,3-oxazol-2-yl)piperidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[(2S)-2-(5-benzyl-1,3-oxazol-2-yl)piperidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 124955389 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-[(2S)-2-(5-benzyl-1,3-oxazol-2-yl)piperidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCCC[C@H]1c1ncc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C18H22N2O3/c1-22-13-17(21)20-10-6-5-9-16(20)18-19-12-15(23-18)11-14-7-3-2-4-8-14/h2-4,7-8,12,16H,5-6,9-11,13H2,1H3/t16-/m0/s1 |
| InChIKey | FJMFBJDGYHLQSL-INIZCTEOSA-N |
| XLogP | 2.97 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |