C20H25ClN2O4 — CID 124979967
1-[(2R)-2-[5-[(3-chlorophenyl)methyl]-1,3-oxazol-2-yl]piperidin-1-yl]-2-(2-methoxyethoxy)ethanone (PubChem CID 124979967) has the molecular formula C20H25ClN2O4 and a molecular weight of 392.88 g/mol. Its IUPAC name is 1-[(2R)-2-[5-[(3-chlorophenyl)methyl]-1,3-oxazol-2-yl]piperidin-1-yl]-2-(2-methoxyethoxy)ethanone.
| Compound Name | 1-[(2R)-2-[5-[(3-chlorophenyl)methyl]-1,3-oxazol-2-yl]piperidin-1-yl]-2-(2-methoxyethoxy)ethanone |
|---|---|
| PubChem CID | 124979967 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[(2R)-2-[5-[(3-chlorophenyl)methyl]-1,3-oxazol-2-yl]piperidin-1-yl]-2-(2-methoxyethoxy)ethanone |
| SMILES | COCCOCC(=O)N1CCCC[C@@H]1c1ncc(Cc2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C20H25ClN2O4/c1-25-9-10-26-14-19(24)23-8-3-2-7-18(23)20-22-13-17(27-20)12-15-5-4-6-16(21)11-15/h4-6,11,13,18H,2-3,7-10,12,14H2,1H3/t18-/m1/s1 |
| InChIKey | MFJJWQRIVOOLIS-GOSISDBHSA-N |
| XLogP | 3.64 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|