C14H11Br2NO3S — CID 107739226
(E)-3-[3,5-dibromo-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]prop-2-enoic acid (PubChem CID 107739226) has the molecular formula C14H11Br2NO3S and a molecular weight of 433.12 g/mol. Its IUPAC name is (E)-3-[3,5-dibromo-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dibromo-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107739226 |
| Molecular Formula | C14H11Br2NO3S |
| Molecular Weight | 433.12 g/mol |
| Exact Mass | 430.88 |
| IUPAC Name | (E)-3-[3,5-dibromo-4-[(4-methyl-1,3-thiazol-2-yl)methoxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1csc(COc2c(Br)cc(/C=C/C(=O)O)cc2Br)n1 |
| InChI | InChI=1S/C14H11Br2NO3S/c1-8-7-21-12(17-8)6-20-14-10(15)4-9(5-11(14)16)2-3-13(18)19/h2-5,7H,6H2,1H3,(H,18,19)/b3-2+ |
| InChIKey | QEVTTXSEOTWPNW-NSCUHMNNSA-N |
| XLogP | 4.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.12 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|