C21H32O5 — CID 22024909
(E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid (PubChem CID 22024909) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 22024909 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid |
| SMILES | CCCCCCOc1cc(/C=C/C(=O)O)cc(OCCCCCC)c1O |
| InChI | InChI=1S/C21H32O5/c1-3-5-7-9-13-25-18-15-17(11-12-20(22)23)16-19(21(18)24)26-14-10-8-6-4-2/h11-12,15-16,24H,3-10,13-14H2,1-2H3,(H,22,23)/b12-11+ |
| InChIKey | KPSSDMBVMVKEEI-VAWYXSNFSA-N |
| XLogP | 5.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|