(E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid

C21H32O5 — CID 22024909

IUPAC(E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid
SMILESCCCCCCOc1cc(/C=C/C(=O)O)cc(OCCCCCC)c1O
InChIInChI=1S/C21H32O5/c1-3-5-7-9-13-25-18-15-17(11-12-20(22)23)16-19(21(18)24)26-14-10-8-6-4-2/h11-12,15-16,24H,3-10,13-14H2,1-2H3,(H,22,23)/b12-11+
InChIKeyKPSSDMBVMVKEEI-VAWYXSNFSA-N
MW364.48 g/mol
LogP5.41
Rot. Bonds14

About (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid

(E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid (PubChem CID 22024909) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid
PubChem CID22024909
Molecular FormulaC21H32O5
Molecular Weight364.48 g/mol
Exact Mass364.22
IUPAC Name(E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid
SMILESCCCCCCOc1cc(/C=C/C(=O)O)cc(OCCCCCC)c1O
InChIInChI=1S/C21H32O5/c1-3-5-7-9-13-25-18-15-17(11-12-20(22)23)16-19(21(18)24)26-14-10-8-6-4-2/h11-12,15-16,24H,3-10,13-14H2,1-2H3,(H,22,23)/b12-11+
InChIKeyKPSSDMBVMVKEEI-VAWYXSNFSA-N
XLogP5.41
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds14
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500364.48
LogP ≤ 55.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid?
The IUPAC name of (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid (CID 22024909) is (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid is CCCCCCOc1cc(/C=C/C(=O)O)cc(OCCCCCC)c1O.
What is the InChIKey of (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid?
The InChIKey is KPSSDMBVMVKEEI-VAWYXSNFSA-N. The full InChI is InChI=1S/C21H32O5/c1-3-5-7-9-13-25-18-15-17(11-12-20(22)23)16-19(21(18)24)26-14-10-8-6-4-2/h11-12,15-16,24H,3-10,13-14H2,1-2H3,(H,22,23)/b12-11+.
What are the key properties of (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid?
(E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid has a molecular weight of 364.48 g/mol, XLogP of 5.41, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,5-dihexoxy-4-hydroxyphenyl)prop-2-enoic acid is sourced from PubChem (CID 22024909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).