C23H25NO4 — CID 7139672
2-(3-methoxy-4-pentoxyphenyl)-8-methylquinoline-4-carboxylic acid (PubChem CID 7139672) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(3-methoxy-4-pentoxyphenyl)-8-methylquinoline-4-carboxylic acid.
| Compound Name | 2-(3-methoxy-4-pentoxyphenyl)-8-methylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 7139672 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-(3-methoxy-4-pentoxyphenyl)-8-methylquinoline-4-carboxylic acid |
| SMILES | CCCCCOc1ccc(-c2cc(C(=O)O)c3cccc(C)c3n2)cc1OC |
| InChI | InChI=1S/C23H25NO4/c1-4-5-6-12-28-20-11-10-16(13-21(20)27-3)19-14-18(23(25)26)17-9-7-8-15(2)22(17)24-19/h7-11,13-14H,4-6,12H2,1-3H3,(H,25,26) |
| InChIKey | UZQMLKXETBOASJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|