C25H33NO6 — CID 19232519
diethyl 4-(3-methoxy-4-pentoxyphenyl)-2,6-dimethylpyridine-3,5-dicarboxylate (PubChem CID 19232519) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is diethyl 4-(3-methoxy-4-pentoxyphenyl)-2,6-dimethylpyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(3-methoxy-4-pentoxyphenyl)-2,6-dimethylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19232519 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | diethyl 4-(3-methoxy-4-pentoxyphenyl)-2,6-dimethylpyridine-3,5-dicarboxylate |
| SMILES | CCCCCOc1ccc(-c2c(C(=O)OCC)c(C)nc(C)c2C(=O)OCC)cc1OC |
| InChI | InChI=1S/C25H33NO6/c1-7-10-11-14-32-19-13-12-18(15-20(19)29-6)23-21(24(27)30-8-2)16(4)26-17(5)22(23)25(28)31-9-3/h12-13,15H,7-11,14H2,1-6H3 |
| InChIKey | VDZHVAYTQBSPGY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|