About diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate
diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate (PubChem CID 19232686) has the molecular formula C28H30ClNO6
and a molecular weight of 512.00 g/mol. Its IUPAC name is diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate |
| PubChem CID | 19232686 |
| Molecular Formula | C28H30ClNO6 |
| Molecular Weight | 512.00 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)nc(C)c(C(=O)OCC)c1-c1ccc(OCc2ccc(Cl)cc2)c(OCC)c1 |
| InChI | InChI=1S/C28H30ClNO6/c1-6-33-23-15-20(11-14-22(23)36-16-19-9-12-21(29)13-10-19)26-24(27(31)34-7-2)17(4)30-18(5)25(26)28(32)35-8-3/h9-15H,6-8,16H2,1-5H3 |
| InChIKey | INTXJCUTVFMRHO-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.00 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate (CID 19232686) is diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate is CCOC(=O)c1c(C)nc(C)c(C(=O)OCC)c1-c1ccc(OCc2ccc(Cl)cc2)c(OCC)c1.
What is the InChIKey of diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate?
The InChIKey is INTXJCUTVFMRHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30ClNO6/c1-6-33-23-15-20(11-14-22(23)36-16-19-9-12-21(29)13-10-19)26-24(27(31)34-7-2)17(4)30-18(5)25(26)28(32)35-8-3/h9-15H,6-8,16H2,1-5H3.
What are the key properties of diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate?
diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate has a molecular weight of 512.00 g/mol, XLogP of 6.35, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,6-dimethylpyridine-3,5-dicarboxylate is sourced from PubChem (CID 19232686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).