C17H17NO6 — CID 3434675
4-(3,4-dimethoxyphenyl)-2,6-dimethylpyridine-3,5-dicarboxylic acid (PubChem CID 3434675) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2,6-dimethylpyridine-3,5-dicarboxylic acid.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2,6-dimethylpyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 3434675 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2,6-dimethylpyridine-3,5-dicarboxylic acid |
| SMILES | COc1ccc(-c2c(C(=O)O)c(C)nc(C)c2C(=O)O)cc1OC |
| InChI | InChI=1S/C17H17NO6/c1-8-13(16(19)20)15(14(17(21)22)9(2)18-8)10-5-6-11(23-3)12(7-10)24-4/h5-7H,1-4H3,(H,19,20)(H,21,22) |
| InChIKey | ZTDALACZAOUAOM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |