About 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride
4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride (PubChem CID 139270209) has the molecular formula C9H12ClNO4
and a molecular weight of 233.65 g/mol. Its IUPAC name is 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride.
Analyze 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride?
The IUPAC name of 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride (CID 139270209) is 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride.
What is the SMILES notation for 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride?
The canonical SMILES for 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride is COc1cc(OC)c(C(=O)O)c(C)n1.Cl.
What is the InChIKey of 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride?
The InChIKey is MJGTYEOPCODOJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4.ClH/c1-5-8(9(11)12)6(13-2)4-7(10-5)14-3;/h4H,1-3H3,(H,11,12);1H.
What are the key properties of 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride?
4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride has a molecular weight of 233.65 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy-2-methylpyridine-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 139270209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).