C9H10F2N2O3 — CID 118809246
2-(difluoromethyl)-4,6-dimethoxypyridine-3-carboxamide (PubChem CID 118809246) has the molecular formula C9H10F2N2O3 and a molecular weight of 232.19 g/mol. Its IUPAC name is 2-(difluoromethyl)-4,6-dimethoxypyridine-3-carboxamide.
| Compound Name | 2-(difluoromethyl)-4,6-dimethoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 118809246 |
| Molecular Formula | C9H10F2N2O3 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-(difluoromethyl)-4,6-dimethoxypyridine-3-carboxamide |
| SMILES | COc1cc(OC)c(C(N)=O)c(C(F)F)n1 |
| InChI | InChI=1S/C9H10F2N2O3/c1-15-4-3-5(16-2)13-7(8(10)11)6(4)9(12)14/h3,8H,1-2H3,(H2,12,14) |
| InChIKey | ORIUODWPEJHQSZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |