C11H10F5NO4 — CID 134668484
ethyl 2-(difluoromethyl)-4-methoxy-6-(trifluoromethoxy)pyridine-3-carboxylate (PubChem CID 134668484) has the molecular formula C11H10F5NO4 and a molecular weight of 315.19 g/mol. Its IUPAC name is ethyl 2-(difluoromethyl)-4-methoxy-6-(trifluoromethoxy)pyridine-3-carboxylate.
| Compound Name | ethyl 2-(difluoromethyl)-4-methoxy-6-(trifluoromethoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134668484 |
| Molecular Formula | C11H10F5NO4 |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | ethyl 2-(difluoromethyl)-4-methoxy-6-(trifluoromethoxy)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(OC)cc(OC(F)(F)F)nc1C(F)F |
| InChI | InChI=1S/C11H10F5NO4/c1-3-20-10(18)7-5(19-2)4-6(21-11(14,15)16)17-8(7)9(12)13/h4,9H,3H2,1-2H3 |
| InChIKey | VEGXULRRTSUGRA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |