C11H9F6NO4 — CID 134680122
ethyl 4-methoxy-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 134680122) has the molecular formula C11H9F6NO4 and a molecular weight of 333.18 g/mol. Its IUPAC name is ethyl 4-methoxy-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 4-methoxy-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134680122 |
| Molecular Formula | C11H9F6NO4 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | ethyl 4-methoxy-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(OC)cc(C(F)(F)F)nc1OC(F)(F)F |
| InChI | InChI=1S/C11H9F6NO4/c1-3-21-9(19)7-5(20-2)4-6(10(12,13)14)18-8(7)22-11(15,16)17/h4H,3H2,1-2H3 |
| InChIKey | KJSPVULFHVBVQR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |