C9H6F5NO3 — CID 118803490
2-(difluoromethyl)-4-methyl-6-(trifluoromethoxy)pyridine-3-carboxylic acid (PubChem CID 118803490) has the molecular formula C9H6F5NO3 and a molecular weight of 271.14 g/mol. Its IUPAC name is 2-(difluoromethyl)-4-methyl-6-(trifluoromethoxy)pyridine-3-carboxylic acid.
| Compound Name | 2-(difluoromethyl)-4-methyl-6-(trifluoromethoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118803490 |
| Molecular Formula | C9H6F5NO3 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-(difluoromethyl)-4-methyl-6-(trifluoromethoxy)pyridine-3-carboxylic acid |
| SMILES | Cc1cc(OC(F)(F)F)nc(C(F)F)c1C(=O)O |
| InChI | InChI=1S/C9H6F5NO3/c1-3-2-4(18-9(12,13)14)15-6(7(10)11)5(3)8(16)17/h2,7H,1H3,(H,16,17) |
| InChIKey | PVUAPGJIUPPYBL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |