C9H11F2N3O2 — CID 134684313
ethyl 4,6-diamino-2-(difluoromethyl)pyridine-3-carboxylate (PubChem CID 134684313) has the molecular formula C9H11F2N3O2 and a molecular weight of 231.20 g/mol. Its IUPAC name is ethyl 4,6-diamino-2-(difluoromethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 4,6-diamino-2-(difluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134684313 |
| Molecular Formula | C9H11F2N3O2 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | ethyl 4,6-diamino-2-(difluoromethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)cc(N)nc1C(F)F |
| InChI | InChI=1S/C9H11F2N3O2/c1-2-16-9(15)6-4(12)3-5(13)14-7(6)8(10)11/h3,8H,2H2,1H3,(H4,12,13,14) |
| InChIKey | KUZTZBFCOZULHJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |