C10H10F3NO4 — CID 134670018
2-[6-methoxy-2-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid (PubChem CID 134670018) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is 2-[6-methoxy-2-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid.
| Compound Name | 2-[6-methoxy-2-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134670018 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-[6-methoxy-2-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid |
| SMILES | COc1cc(OC(F)(F)F)c(CC(=O)O)c(C)n1 |
| InChI | InChI=1S/C10H10F3NO4/c1-5-6(3-9(15)16)7(18-10(11,12)13)4-8(14-5)17-2/h4H,3H2,1-2H3,(H,15,16) |
| InChIKey | HKJXTIXPXYFVJN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |