C9H5F6NO4 — CID 134676940
6-methoxy-4-(trifluoromethoxy)-3-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 134676940) has the molecular formula C9H5F6NO4 and a molecular weight of 305.13 g/mol. Its IUPAC name is 6-methoxy-4-(trifluoromethoxy)-3-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | 6-methoxy-4-(trifluoromethoxy)-3-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 134676940 |
| Molecular Formula | C9H5F6NO4 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 6-methoxy-4-(trifluoromethoxy)-3-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | COc1cc(OC(F)(F)F)c(C(F)(F)F)c(C(=O)O)n1 |
| InChI | InChI=1S/C9H5F6NO4/c1-19-4-2-3(20-9(13,14)15)5(8(10,11)12)6(16-4)7(17)18/h2H,1H3,(H,17,18) |
| InChIKey | PFDVOVKBOJQARN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |