C10H7F6NO4 — CID 134669973
2-[6-methoxy-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]acetic acid (PubChem CID 134669973) has the molecular formula C10H7F6NO4 and a molecular weight of 319.16 g/mol. Its IUPAC name is 2-[6-methoxy-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]acetic acid.
| Compound Name | 2-[6-methoxy-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134669973 |
| Molecular Formula | C10H7F6NO4 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-[6-methoxy-4-(trifluoromethoxy)-3-(trifluoromethyl)-2-pyridinyl]acetic acid |
| SMILES | COc1cc(OC(F)(F)F)c(C(F)(F)F)c(CC(=O)O)n1 |
| InChI | InChI=1S/C10H7F6NO4/c1-20-6-3-5(21-10(14,15)16)8(9(11,12)13)4(17-6)2-7(18)19/h3H,2H2,1H3,(H,18,19) |
| InChIKey | VWFCISKQSOORNY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |