C9H7F3INO3 — CID 134661419
2-[2-iodo-6-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid (PubChem CID 134661419) has the molecular formula C9H7F3INO3 and a molecular weight of 361.06 g/mol. Its IUPAC name is 2-[2-iodo-6-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid.
| Compound Name | 2-[2-iodo-6-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134661419 |
| Molecular Formula | C9H7F3INO3 |
| Molecular Weight | 361.06 g/mol |
| Exact Mass | 360.94 |
| IUPAC Name | 2-[2-iodo-6-methyl-4-(trifluoromethoxy)-3-pyridinyl]acetic acid |
| SMILES | Cc1cc(OC(F)(F)F)c(CC(=O)O)c(I)n1 |
| InChI | InChI=1S/C9H7F3INO3/c1-4-2-6(17-9(10,11)12)5(3-7(15)16)8(13)14-4/h2H,3H2,1H3,(H,15,16) |
| InChIKey | LLTPSTPFHMVNCQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.06 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|