C9H6F3IO3 — CID 170998285
2-[4-iodo-3-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 170998285) has the molecular formula C9H6F3IO3 and a molecular weight of 346.04 g/mol. Its IUPAC name is 2-[4-iodo-3-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-[4-iodo-3-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 170998285 |
| Molecular Formula | C9H6F3IO3 |
| Molecular Weight | 346.04 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | 2-[4-iodo-3-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(I)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F3IO3/c10-9(11,12)16-7-3-5(4-8(14)15)1-2-6(7)13/h1-3H,4H2,(H,14,15) |
| InChIKey | VQVWVMYYNNQGDT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.04 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|