C10H7F5O3 — CID 170998831
2-[4-(difluoromethyl)-3-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 170998831) has the molecular formula C10H7F5O3 and a molecular weight of 270.15 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-3-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-[4-(difluoromethyl)-3-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 170998831 |
| Molecular Formula | C10H7F5O3 |
| Molecular Weight | 270.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-[4-(difluoromethyl)-3-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(C(F)F)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C10H7F5O3/c11-9(12)6-2-1-5(4-8(16)17)3-7(6)18-10(13,14)15/h1-3,9H,4H2,(H,16,17) |
| InChIKey | BTIFHCXMEDOKAN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |