C15H10F4O3 — CID 134620292
2-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]acetic acid (PubChem CID 134620292) has the molecular formula C15H10F4O3 and a molecular weight of 314.23 g/mol. Its IUPAC name is 2-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]acetic acid.
| Compound Name | 2-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 134620292 |
| Molecular Formula | C15H10F4O3 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-[3-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2ccc(OC(F)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C15H10F4O3/c16-13-7-9(8-14(20)21)1-6-12(13)10-2-4-11(5-3-10)22-15(17,18)19/h1-7H,8H2,(H,20,21) |
| InChIKey | NKOPGXDKJPGCNO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |