C10H11F3N2O3 — CID 133085499
2-[6-(aminomethyl)-4-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetic acid (PubChem CID 133085499) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is 2-[6-(aminomethyl)-4-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetic acid.
| Compound Name | 2-[6-(aminomethyl)-4-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 133085499 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-[6-(aminomethyl)-4-methyl-2-(trifluoromethoxy)-3-pyridinyl]acetic acid |
| SMILES | Cc1cc(CN)nc(OC(F)(F)F)c1CC(=O)O |
| InChI | InChI=1S/C10H11F3N2O3/c1-5-2-6(4-14)15-9(18-10(11,12)13)7(5)3-8(16)17/h2H,3-4,14H2,1H3,(H,16,17) |
| InChIKey | KWTUKKMYDKBKHO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |