C10H8F6N2O3 — CID 134667673
2-[6-(aminomethyl)-2-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]acetic acid (PubChem CID 134667673) has the molecular formula C10H8F6N2O3 and a molecular weight of 318.17 g/mol. Its IUPAC name is 2-[6-(aminomethyl)-2-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]acetic acid.
| Compound Name | 2-[6-(aminomethyl)-2-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134667673 |
| Molecular Formula | C10H8F6N2O3 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-[6-(aminomethyl)-2-(trifluoromethoxy)-3-(trifluoromethyl)-4-pyridinyl]acetic acid |
| SMILES | NCc1cc(CC(=O)O)c(C(F)(F)F)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C10H8F6N2O3/c11-9(12,13)7-4(2-6(19)20)1-5(3-17)18-8(7)21-10(14,15)16/h1H,2-3,17H2,(H,19,20) |
| InChIKey | OAVCKFWIDXKWTN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |