C10H7ClF5NO3 — CID 134682629
2-[4-(chloromethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)-2-pyridinyl]acetic acid (PubChem CID 134682629) has the molecular formula C10H7ClF5NO3 and a molecular weight of 319.61 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)-2-pyridinyl]acetic acid.
| Compound Name | 2-[4-(chloromethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134682629 |
| Molecular Formula | C10H7ClF5NO3 |
| Molecular Weight | 319.61 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 2-[4-(chloromethyl)-5-(difluoromethyl)-6-(trifluoromethoxy)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(CCl)c(C(F)F)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C10H7ClF5NO3/c11-3-4-1-5(2-6(18)19)17-9(7(4)8(12)13)20-10(14,15)16/h1,8H,2-3H2,(H,18,19) |
| InChIKey | FBNONGGMCYRFJG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|