C9H5F6NO3 — CID 134680885
2-[6-(difluoromethyl)-4-fluoro-5-(trifluoromethoxy)-2-pyridinyl]acetic acid (PubChem CID 134680885) has the molecular formula C9H5F6NO3 and a molecular weight of 289.13 g/mol. Its IUPAC name is 2-[6-(difluoromethyl)-4-fluoro-5-(trifluoromethoxy)-2-pyridinyl]acetic acid.
| Compound Name | 2-[6-(difluoromethyl)-4-fluoro-5-(trifluoromethoxy)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134680885 |
| Molecular Formula | C9H5F6NO3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-[6-(difluoromethyl)-4-fluoro-5-(trifluoromethoxy)-2-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(F)c(OC(F)(F)F)c(C(F)F)n1 |
| InChI | InChI=1S/C9H5F6NO3/c10-4-1-3(2-5(17)18)16-6(8(11)12)7(4)19-9(13,14)15/h1,8H,2H2,(H,17,18) |
| InChIKey | RTGKGOZQSNLURH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |