C10H9F5N2O3 — CID 118820188
2-[2-(aminomethyl)-6-(difluoromethyl)-3-(trifluoromethoxy)-4-pyridinyl]acetic acid (PubChem CID 118820188) has the molecular formula C10H9F5N2O3 and a molecular weight of 300.18 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-6-(difluoromethyl)-3-(trifluoromethoxy)-4-pyridinyl]acetic acid.
| Compound Name | 2-[2-(aminomethyl)-6-(difluoromethyl)-3-(trifluoromethoxy)-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 118820188 |
| Molecular Formula | C10H9F5N2O3 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[2-(aminomethyl)-6-(difluoromethyl)-3-(trifluoromethoxy)-4-pyridinyl]acetic acid |
| SMILES | NCc1nc(C(F)F)cc(CC(=O)O)c1OC(F)(F)F |
| InChI | InChI=1S/C10H9F5N2O3/c11-9(12)5-1-4(2-7(18)19)8(6(3-16)17-5)20-10(13,14)15/h1,9H,2-3,16H2,(H,18,19) |
| InChIKey | QHTGTCCBAHPHAT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |