C8H8F5N3O — CID 119011988
4-(aminomethyl)-6-(difluoromethyl)-3-(trifluoromethoxy)pyridin-2-amine (PubChem CID 119011988) has the molecular formula C8H8F5N3O and a molecular weight of 257.16 g/mol. Its IUPAC name is 4-(aminomethyl)-6-(difluoromethyl)-3-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | 4-(aminomethyl)-6-(difluoromethyl)-3-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 119011988 |
| Molecular Formula | C8H8F5N3O |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-(aminomethyl)-6-(difluoromethyl)-3-(trifluoromethoxy)pyridin-2-amine |
| SMILES | NCc1cc(C(F)F)nc(N)c1OC(F)(F)F |
| InChI | InChI=1S/C8H8F5N3O/c9-6(10)4-1-3(2-14)5(7(15)16-4)17-8(11,12)13/h1,6H,2,14H2,(H2,15,16) |
| InChIKey | XLDIJLQTKNHQSO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |