C9H9F5N2O2 — CID 134678172
[2-(difluoromethyl)-3-methoxy-6-(trifluoromethoxy)-4-pyridinyl]methanamine (PubChem CID 134678172) has the molecular formula C9H9F5N2O2 and a molecular weight of 272.17 g/mol. Its IUPAC name is [2-(difluoromethyl)-3-methoxy-6-(trifluoromethoxy)-4-pyridinyl]methanamine.
| Compound Name | [2-(difluoromethyl)-3-methoxy-6-(trifluoromethoxy)-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 134678172 |
| Molecular Formula | C9H9F5N2O2 |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | [2-(difluoromethyl)-3-methoxy-6-(trifluoromethoxy)-4-pyridinyl]methanamine |
| SMILES | COc1c(CN)cc(OC(F)(F)F)nc1C(F)F |
| InChI | InChI=1S/C9H9F5N2O2/c1-17-7-4(3-15)2-5(18-9(12,13)14)16-6(7)8(10)11/h2,8H,3,15H2,1H3 |
| InChIKey | VOCMQFSAUCJODM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |