C8H8F5N3O3S — CID 118846600
4-(aminomethyl)-2-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-sulfonamide (PubChem CID 118846600) has the molecular formula C8H8F5N3O3S and a molecular weight of 321.23 g/mol. Its IUPAC name is 4-(aminomethyl)-2-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-sulfonamide.
| Compound Name | 4-(aminomethyl)-2-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118846600 |
| Molecular Formula | C8H8F5N3O3S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 4-(aminomethyl)-2-(difluoromethyl)-6-(trifluoromethoxy)pyridine-3-sulfonamide |
| SMILES | NCc1cc(OC(F)(F)F)nc(C(F)F)c1S(N)(=O)=O |
| InChI | InChI=1S/C8H8F5N3O3S/c9-7(10)5-6(20(15,17)18)3(2-14)1-4(16-5)19-8(11,12)13/h1,7H,2,14H2,(H2,15,17,18) |
| InChIKey | UMHYIBHVGPMPOZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |