C8H7F6N3O — CID 133086394
4-(aminomethyl)-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridin-3-amine (PubChem CID 133086394) has the molecular formula C8H7F6N3O and a molecular weight of 275.15 g/mol. Its IUPAC name is 4-(aminomethyl)-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridin-3-amine.
| Compound Name | 4-(aminomethyl)-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 133086394 |
| Molecular Formula | C8H7F6N3O |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 4-(aminomethyl)-6-(trifluoromethoxy)-2-(trifluoromethyl)pyridin-3-amine |
| SMILES | NCc1cc(OC(F)(F)F)nc(C(F)(F)F)c1N |
| InChI | InChI=1S/C8H7F6N3O/c9-7(10,11)6-5(16)3(2-15)1-4(17-6)18-8(12,13)14/h1H,2,15-16H2 |
| InChIKey | XJQVXLKVNKKSSN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |